C18H16N4O2S2 — CID 667182
2-(3-pyrrolidin-1-ylquinoxalin-2-yl)-2-thiophen-2-ylsulfonylacetonitrile (PubChem CID 667182) has the molecular formula C18H16N4O2S2 and a molecular weight of 384.49 g/mol. Its IUPAC name is 2-(3-pyrrolidin-1-ylquinoxalin-2-yl)-2-thiophen-2-ylsulfonylacetonitrile.
| Compound Name | 2-(3-pyrrolidin-1-ylquinoxalin-2-yl)-2-thiophen-2-ylsulfonylacetonitrile |
|---|---|
| PubChem CID | 667182 |
| Molecular Formula | C18H16N4O2S2 |
| Molecular Weight | 384.49 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 2-(3-pyrrolidin-1-ylquinoxalin-2-yl)-2-thiophen-2-ylsulfonylacetonitrile |
| SMILES | N#CC(c1nc2ccccc2nc1N1CCCC1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C18H16N4O2S2/c19-12-15(26(23,24)16-8-5-11-25-16)17-18(22-9-3-4-10-22)21-14-7-2-1-6-13(14)20-17/h1-2,5-8,11,15H,3-4,9-10H2 |
| InChIKey | LDZFLUKAAFJUEB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 86.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |