C22H23N5OS — CID 71559907
2-[3-(azepan-1-yl)quinoxalin-2-yl]-2-cyano-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 71559907) has the molecular formula C22H23N5OS and a molecular weight of 405.53 g/mol. Its IUPAC name is 2-[3-(azepan-1-yl)quinoxalin-2-yl]-2-cyano-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[3-(azepan-1-yl)quinoxalin-2-yl]-2-cyano-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 71559907 |
| Molecular Formula | C22H23N5OS |
| Molecular Weight | 405.53 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 2-[3-(azepan-1-yl)quinoxalin-2-yl]-2-cyano-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | N#CC(C(=O)NCc1cccs1)c1nc2ccccc2nc1N1CCCCCC1 |
| InChI | InChI=1S/C22H23N5OS/c23-14-17(22(28)24-15-16-8-7-13-29-16)20-21(27-11-5-1-2-6-12-27)26-19-10-4-3-9-18(19)25-20/h3-4,7-10,13,17H,1-2,5-6,11-12,15H2,(H,24,28) |
| InChIKey | XZEZHNHAUPOQEQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |