C25H23FN3O2S+ — CID 2138471
3-(benzenesulfonyl)-4-[4-(4-fluorophenyl)piperazin-1-yl]quinolin-1-ium (PubChem CID 2138471) has the molecular formula C25H23FN3O2S+ and a molecular weight of 448.54 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-4-[4-(4-fluorophenyl)piperazin-1-yl]quinolin-1-ium.
| Compound Name | 3-(benzenesulfonyl)-4-[4-(4-fluorophenyl)piperazin-1-yl]quinolin-1-ium |
|---|---|
| PubChem CID | 2138471 |
| Molecular Formula | C25H23FN3O2S+ |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 3-(benzenesulfonyl)-4-[4-(4-fluorophenyl)piperazin-1-yl]quinolin-1-ium |
| SMILES | O=S(=O)(c1ccccc1)c1c[nH+]c2ccccc2c1N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C25H22FN3O2S/c26-19-10-12-20(13-11-19)28-14-16-29(17-15-28)25-22-8-4-5-9-23(22)27-18-24(25)32(30,31)21-6-2-1-3-7-21/h1-13,18H,14-17H2/p+1 |
| InChIKey | GIHCNFVNYRUVCR-UHFFFAOYSA-O |
| XLogP | 3.95 |
| TPSA | 54.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |