C21H23N2O4S+ — CID 2144810
4-[6-methoxy-3-(4-methylphenyl)sulfonylquinolin-1-ium-4-yl]morpholine (PubChem CID 2144810) has the molecular formula C21H23N2O4S+ and a molecular weight of 399.49 g/mol. Its IUPAC name is 4-[6-methoxy-3-(4-methylphenyl)sulfonylquinolin-1-ium-4-yl]morpholine.
| Compound Name | 4-[6-methoxy-3-(4-methylphenyl)sulfonylquinolin-1-ium-4-yl]morpholine |
|---|---|
| PubChem CID | 2144810 |
| Molecular Formula | C21H23N2O4S+ |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 4-[6-methoxy-3-(4-methylphenyl)sulfonylquinolin-1-ium-4-yl]morpholine |
| SMILES | COc1ccc2[nH+]cc(S(=O)(=O)c3ccc(C)cc3)c(N3CCOCC3)c2c1 |
| InChI | InChI=1S/C21H22N2O4S/c1-15-3-6-17(7-4-15)28(24,25)20-14-22-19-8-5-16(26-2)13-18(19)21(20)23-9-11-27-12-10-23/h3-8,13-14H,9-12H2,1-2H3/p+1 |
| InChIKey | NSTAYTILQPOVTA-UHFFFAOYSA-O |
| XLogP | 2.64 |
| TPSA | 69.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |