C22H25N2O3S+ — CID 7470603
3-(benzenesulfonyl)-6-methoxy-4-[(3S)-3-methylpiperidin-1-yl]quinolin-1-ium (PubChem CID 7470603) has the molecular formula C22H25N2O3S+ and a molecular weight of 397.52 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-6-methoxy-4-[(3S)-3-methylpiperidin-1-yl]quinolin-1-ium.
| Compound Name | 3-(benzenesulfonyl)-6-methoxy-4-[(3S)-3-methylpiperidin-1-yl]quinolin-1-ium |
|---|---|
| PubChem CID | 7470603 |
| Molecular Formula | C22H25N2O3S+ |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 3-(benzenesulfonyl)-6-methoxy-4-[(3S)-3-methylpiperidin-1-yl]quinolin-1-ium |
| SMILES | COc1ccc2[nH+]cc(S(=O)(=O)c3ccccc3)c(N3CCC[C@H](C)C3)c2c1 |
| InChI | InChI=1S/C22H24N2O3S/c1-16-7-6-12-24(15-16)22-19-13-17(27-2)10-11-20(19)23-14-21(22)28(25,26)18-8-4-3-5-9-18/h3-5,8-11,13-14,16H,6-7,12,15H2,1-2H3/p+1/t16-/m0/s1 |
| InChIKey | VSQIZZSBFWAXDM-INIZCTEOSA-O |
| XLogP | 3.73 |
| TPSA | 60.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |