C23H27N2O4S+ — CID 2150562
6-ethoxy-3-(4-methoxyphenyl)sulfonyl-4-piperidin-1-ylquinolin-1-ium (PubChem CID 2150562) has the molecular formula C23H27N2O4S+ and a molecular weight of 427.55 g/mol. Its IUPAC name is 6-ethoxy-3-(4-methoxyphenyl)sulfonyl-4-piperidin-1-ylquinolin-1-ium.
| Compound Name | 6-ethoxy-3-(4-methoxyphenyl)sulfonyl-4-piperidin-1-ylquinolin-1-ium |
|---|---|
| PubChem CID | 2150562 |
| Molecular Formula | C23H27N2O4S+ |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 6-ethoxy-3-(4-methoxyphenyl)sulfonyl-4-piperidin-1-ylquinolin-1-ium |
| SMILES | CCOc1ccc2[nH+]cc(S(=O)(=O)c3ccc(OC)cc3)c(N3CCCCC3)c2c1 |
| InChI | InChI=1S/C23H26N2O4S/c1-3-29-18-9-12-21-20(15-18)23(25-13-5-4-6-14-25)22(16-24-21)30(26,27)19-10-7-17(28-2)8-11-19/h7-12,15-16H,3-6,13-14H2,1-2H3/p+1 |
| InChIKey | OWYAAMBSHKFCSS-UHFFFAOYSA-O |
| XLogP | 3.88 |
| TPSA | 69.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |