C23H27N2O3S+ — CID 2150538
6-methoxy-3-(4-methylphenyl)sulfonyl-4-[(3R)-3-methylpiperidin-1-yl]quinolin-1-ium (PubChem CID 2150538) has the molecular formula C23H27N2O3S+ and a molecular weight of 411.55 g/mol. Its IUPAC name is 6-methoxy-3-(4-methylphenyl)sulfonyl-4-[(3R)-3-methylpiperidin-1-yl]quinolin-1-ium.
| Compound Name | 6-methoxy-3-(4-methylphenyl)sulfonyl-4-[(3R)-3-methylpiperidin-1-yl]quinolin-1-ium |
|---|---|
| PubChem CID | 2150538 |
| Molecular Formula | C23H27N2O3S+ |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 6-methoxy-3-(4-methylphenyl)sulfonyl-4-[(3R)-3-methylpiperidin-1-yl]quinolin-1-ium |
| SMILES | COc1ccc2[nH+]cc(S(=O)(=O)c3ccc(C)cc3)c(N3CCC[C@@H](C)C3)c2c1 |
| InChI | InChI=1S/C23H26N2O3S/c1-16-6-9-19(10-7-16)29(26,27)22-14-24-21-11-8-18(28-3)13-20(21)23(22)25-12-4-5-17(2)15-25/h6-11,13-14,17H,4-5,12,15H2,1-3H3/p+1/t17-/m1/s1 |
| InChIKey | BURXHQCKGIOXRQ-QGZVFWFLSA-O |
| XLogP | 4.04 |
| TPSA | 60.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |