C23H29N3O2S+2 — CID 2140979
4-(4-ethylpiperazin-4-ium-1-yl)-6-methyl-3-(4-methylphenyl)sulfonylquinolin-1-ium (PubChem CID 2140979) has the molecular formula C23H29N3O2S+2 and a molecular weight of 411.57 g/mol. Its IUPAC name is 4-(4-ethylpiperazin-4-ium-1-yl)-6-methyl-3-(4-methylphenyl)sulfonylquinolin-1-ium.
| Compound Name | 4-(4-ethylpiperazin-4-ium-1-yl)-6-methyl-3-(4-methylphenyl)sulfonylquinolin-1-ium |
|---|---|
| PubChem CID | 2140979 |
| Molecular Formula | C23H29N3O2S+2 |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 4-(4-ethylpiperazin-4-ium-1-yl)-6-methyl-3-(4-methylphenyl)sulfonylquinolin-1-ium |
| SMILES | CC[NH+]1CCN(c2c(S(=O)(=O)c3ccc(C)cc3)c[nH+]c3ccc(C)cc23)CC1 |
| InChI | InChI=1S/C23H27N3O2S/c1-4-25-11-13-26(14-12-25)23-20-15-18(3)7-10-21(20)24-16-22(23)29(27,28)19-8-5-17(2)6-9-19/h5-10,15-16H,4,11-14H2,1-3H3/p+2 |
| InChIKey | OCCCAZXKDSJWSR-UHFFFAOYSA-P |
| XLogP | 1.83 |
| TPSA | 55.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |