C21H25N3O2S+2 — CID 2140977
3-(4-methylphenyl)sulfonyl-4-(4-methylpiperazin-4-ium-1-yl)quinolin-1-ium (PubChem CID 2140977) has the molecular formula C21H25N3O2S+2 and a molecular weight of 383.52 g/mol. Its IUPAC name is 3-(4-methylphenyl)sulfonyl-4-(4-methylpiperazin-4-ium-1-yl)quinolin-1-ium.
| Compound Name | 3-(4-methylphenyl)sulfonyl-4-(4-methylpiperazin-4-ium-1-yl)quinolin-1-ium |
|---|---|
| PubChem CID | 2140977 |
| Molecular Formula | C21H25N3O2S+2 |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 3-(4-methylphenyl)sulfonyl-4-(4-methylpiperazin-4-ium-1-yl)quinolin-1-ium |
| SMILES | Cc1ccc(S(=O)(=O)c2c[nH+]c3ccccc3c2N2CC[NH+](C)CC2)cc1 |
| InChI | InChI=1S/C21H23N3O2S/c1-16-7-9-17(10-8-16)27(25,26)20-15-22-19-6-4-3-5-18(19)21(20)24-13-11-23(2)12-14-24/h3-10,15H,11-14H2,1-2H3/p+2 |
| InChIKey | HKLUQGJTZQDDMH-UHFFFAOYSA-P |
| XLogP | 1.13 |
| TPSA | 55.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |