C21H22ClN2O2S+ — CID 7184575
3-(4-chlorophenyl)sulfonyl-6-ethyl-4-pyrrolidin-1-ylquinolin-1-ium (PubChem CID 7184575) has the molecular formula C21H22ClN2O2S+ and a molecular weight of 401.94 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfonyl-6-ethyl-4-pyrrolidin-1-ylquinolin-1-ium.
| Compound Name | 3-(4-chlorophenyl)sulfonyl-6-ethyl-4-pyrrolidin-1-ylquinolin-1-ium |
|---|---|
| PubChem CID | 7184575 |
| Molecular Formula | C21H22ClN2O2S+ |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 3-(4-chlorophenyl)sulfonyl-6-ethyl-4-pyrrolidin-1-ylquinolin-1-ium |
| SMILES | CCc1ccc2[nH+]cc(S(=O)(=O)c3ccc(Cl)cc3)c(N3CCCC3)c2c1 |
| InChI | InChI=1S/C21H21ClN2O2S/c1-2-15-5-10-19-18(13-15)21(24-11-3-4-12-24)20(14-23-19)27(25,26)17-8-6-16(22)7-9-17/h5-10,13-14H,2-4,11-12H2,1H3/p+1 |
| InChIKey | DOUJRGHKWPCOSF-UHFFFAOYSA-O |
| XLogP | 4.30 |
| TPSA | 51.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |