C25H24N2O3S — CID 18590209
N-benzyl-6-ethoxy-3-(4-methylphenyl)sulfonylquinolin-4-amine (PubChem CID 18590209) has the molecular formula C25H24N2O3S and a molecular weight of 432.55 g/mol. Its IUPAC name is N-benzyl-6-ethoxy-3-(4-methylphenyl)sulfonylquinolin-4-amine.
| Compound Name | N-benzyl-6-ethoxy-3-(4-methylphenyl)sulfonylquinolin-4-amine |
|---|---|
| PubChem CID | 18590209 |
| Molecular Formula | C25H24N2O3S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | N-benzyl-6-ethoxy-3-(4-methylphenyl)sulfonylquinolin-4-amine |
| SMILES | CCOc1ccc2ncc(S(=O)(=O)c3ccc(C)cc3)c(NCc3ccccc3)c2c1 |
| InChI | InChI=1S/C25H24N2O3S/c1-3-30-20-11-14-23-22(15-20)25(27-16-19-7-5-4-6-8-19)24(17-26-23)31(28,29)21-12-9-18(2)10-13-21/h4-15,17H,3,16H2,1-2H3,(H,26,27) |
| InChIKey | NIHMLHMAEZOELG-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |