C19H17ClN4O2S — CID 20884297
N-[(4-chlorophenyl)methyl]-2-(12-ethyl-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)acetamide (PubChem CID 20884297) has the molecular formula C19H17ClN4O2S and a molecular weight of 400.89 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-(12-ethyl-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)acetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-(12-ethyl-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)acetamide |
|---|---|
| PubChem CID | 20884297 |
| Molecular Formula | C19H17ClN4O2S |
| Molecular Weight | 400.89 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-(12-ethyl-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)acetamide |
| SMILES | CCc1nn(CC(=O)NCc2ccc(Cl)cc2)c(=O)c2cc3sccc3n12 |
| InChI | InChI=1S/C19H17ClN4O2S/c1-2-17-22-23(11-18(25)21-10-12-3-5-13(20)6-4-12)19(26)15-9-16-14(24(15)17)7-8-27-16/h3-9H,2,10-11H2,1H3,(H,21,25) |
| InChIKey | PQACZGUAVIRTKY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.89 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |