C12H11N3O3S — CID 126469240
methyl 2-(12-methyl-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)acetate (PubChem CID 126469240) has the molecular formula C12H11N3O3S and a molecular weight of 277.31 g/mol. Its IUPAC name is methyl 2-(12-methyl-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)acetate.
| Compound Name | methyl 2-(12-methyl-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)acetate |
|---|---|
| PubChem CID | 126469240 |
| Molecular Formula | C12H11N3O3S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | methyl 2-(12-methyl-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)acetate |
| SMILES | COC(=O)Cn1nc(C)n2c(cc3sccc32)c1=O |
| InChI | InChI=1S/C12H11N3O3S/c1-7-13-14(6-11(16)18-2)12(17)9-5-10-8(15(7)9)3-4-19-10/h3-5H,6H2,1-2H3 |
| InChIKey | GHVKUWMCGSFASX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |