C14H16N4O3S — CID 168823742
2-[12-[methyl(propyl)amino]-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl]acetic acid (PubChem CID 168823742) has the molecular formula C14H16N4O3S and a molecular weight of 320.37 g/mol. Its IUPAC name is 2-[12-[methyl(propyl)amino]-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl]acetic acid.
| Compound Name | 2-[12-[methyl(propyl)amino]-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl]acetic acid |
|---|---|
| PubChem CID | 168823742 |
| Molecular Formula | C14H16N4O3S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 2-[12-[methyl(propyl)amino]-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl]acetic acid |
| SMILES | CCCN(C)c1nn(CC(=O)O)c(=O)c2cc3sccc3n12 |
| InChI | InChI=1S/C14H16N4O3S/c1-3-5-16(2)14-15-17(8-12(19)20)13(21)10-7-11-9(18(10)14)4-6-22-11/h4,6-7H,3,5,8H2,1-2H3,(H,19,20) |
| InChIKey | QSPJUYDOIACTHR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 79.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |