C21H22N4O2S — CID 6620337
4-(12-methyl-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)-N-(2-phenylethyl)butanamide (PubChem CID 6620337) has the molecular formula C21H22N4O2S and a molecular weight of 394.50 g/mol. Its IUPAC name is 4-(12-methyl-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)-N-(2-phenylethyl)butanamide.
| Compound Name | 4-(12-methyl-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)-N-(2-phenylethyl)butanamide |
|---|---|
| PubChem CID | 6620337 |
| Molecular Formula | C21H22N4O2S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 4-(12-methyl-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)-N-(2-phenylethyl)butanamide |
| SMILES | Cc1nn(CCCC(=O)NCCc2ccccc2)c(=O)c2cc3sccc3n12 |
| InChI | InChI=1S/C21H22N4O2S/c1-15-23-24(21(27)18-14-19-17(25(15)18)10-13-28-19)12-5-8-20(26)22-11-9-16-6-3-2-4-7-16/h2-4,6-7,10,13-14H,5,8-9,11-12H2,1H3,(H,22,26) |
| InChIKey | BRPNUBVEQVETLG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |