C23H24N4O2 — CID 20884684
2-(4,8-dimethyl-1-oxo-[1,2,4]triazino[4,5-a]indol-2-yl)-N-(3-phenylpropyl)acetamide (PubChem CID 20884684) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 2-(4,8-dimethyl-1-oxo-[1,2,4]triazino[4,5-a]indol-2-yl)-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-(4,8-dimethyl-1-oxo-[1,2,4]triazino[4,5-a]indol-2-yl)-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 20884684 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 2-(4,8-dimethyl-1-oxo-[1,2,4]triazino[4,5-a]indol-2-yl)-N-(3-phenylpropyl)acetamide |
| SMILES | Cc1ccc2c(c1)cc1c(=O)n(CC(=O)NCCCc3ccccc3)nc(C)n12 |
| InChI | InChI=1S/C23H24N4O2/c1-16-10-11-20-19(13-16)14-21-23(29)26(25-17(2)27(20)21)15-22(28)24-12-6-9-18-7-4-3-5-8-18/h3-5,7-8,10-11,13-14H,6,9,12,15H2,1-2H3,(H,24,28) |
| InChIKey | QBPIOSYIWWNWRC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|