C19H24N4O4 — CID 20884837
2-(4-ethyl-9-methoxy-1-oxo-[1,2,4]triazino[4,5-a]indol-2-yl)-N-(3-methoxypropyl)acetamide (PubChem CID 20884837) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is 2-(4-ethyl-9-methoxy-1-oxo-[1,2,4]triazino[4,5-a]indol-2-yl)-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-(4-ethyl-9-methoxy-1-oxo-[1,2,4]triazino[4,5-a]indol-2-yl)-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 20884837 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 2-(4-ethyl-9-methoxy-1-oxo-[1,2,4]triazino[4,5-a]indol-2-yl)-N-(3-methoxypropyl)acetamide |
| SMILES | CCc1nn(CC(=O)NCCCOC)c(=O)c2cc3c(OC)cccc3n12 |
| InChI | InChI=1S/C19H24N4O4/c1-4-17-21-22(12-18(24)20-9-6-10-26-2)19(25)15-11-13-14(23(15)17)7-5-8-16(13)27-3/h5,7-8,11H,4,6,9-10,12H2,1-3H3,(H,20,24) |
| InChIKey | FUVGXSCQXIOQHT-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|