C18H21FN4O3 — CID 20885008
2-(4-ethyl-8-fluoro-1-oxo-[1,2,4]triazino[4,5-a]indol-2-yl)-N-(3-methoxypropyl)acetamide (PubChem CID 20885008) has the molecular formula C18H21FN4O3 and a molecular weight of 360.39 g/mol. Its IUPAC name is 2-(4-ethyl-8-fluoro-1-oxo-[1,2,4]triazino[4,5-a]indol-2-yl)-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-(4-ethyl-8-fluoro-1-oxo-[1,2,4]triazino[4,5-a]indol-2-yl)-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 20885008 |
| Molecular Formula | C18H21FN4O3 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 2-(4-ethyl-8-fluoro-1-oxo-[1,2,4]triazino[4,5-a]indol-2-yl)-N-(3-methoxypropyl)acetamide |
| SMILES | CCc1nn(CC(=O)NCCCOC)c(=O)c2cc3cc(F)ccc3n12 |
| InChI | InChI=1S/C18H21FN4O3/c1-3-16-21-22(11-17(24)20-7-4-8-26-2)18(25)15-10-12-9-13(19)5-6-14(12)23(15)16/h5-6,9-10H,3-4,7-8,11H2,1-2H3,(H,20,24) |
| InChIKey | MFXIFZWYUIPUAK-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|