C20H30N4O — CID 20886093
N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-(3-methylindazol-1-yl)acetamide (PubChem CID 20886093) has the molecular formula C20H30N4O and a molecular weight of 342.49 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-(3-methylindazol-1-yl)acetamide.
| Compound Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-(3-methylindazol-1-yl)acetamide |
|---|---|
| PubChem CID | 20886093 |
| Molecular Formula | C20H30N4O |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-(3-methylindazol-1-yl)acetamide |
| SMILES | Cc1nn(CC(=O)NCCCN2CC(C)CC(C)C2)c2ccccc12 |
| InChI | InChI=1S/C20H30N4O/c1-15-11-16(2)13-23(12-15)10-6-9-21-20(25)14-24-19-8-5-4-7-18(19)17(3)22-24/h4-5,7-8,15-16H,6,9-14H2,1-3H3,(H,21,25) |
| InChIKey | CGETZEYEPUIYES-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|