C23H33N5O2S — CID 20884443
N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-(12-ethyl-4-methyl-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)acetamide (PubChem CID 20884443) has the molecular formula C23H33N5O2S and a molecular weight of 443.62 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-(12-ethyl-4-methyl-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)acetamide.
| Compound Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-(12-ethyl-4-methyl-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)acetamide |
|---|---|
| PubChem CID | 20884443 |
| Molecular Formula | C23H33N5O2S |
| Molecular Weight | 443.62 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-(12-ethyl-4-methyl-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)acetamide |
| SMILES | CCc1nn(CC(=O)NCCCN2CC(C)CC(C)C2)c(=O)c2cc3sc(C)cc3n12 |
| InChI | InChI=1S/C23H33N5O2S/c1-5-21-25-27(23(30)19-11-20-18(28(19)21)10-17(4)31-20)14-22(29)24-7-6-8-26-12-15(2)9-16(3)13-26/h10-11,15-16H,5-9,12-14H2,1-4H3,(H,24,29) |
| InChIKey | GMWVIRPICOOFSA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 71.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.62 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|