C18H24N4O2S — CID 53298229
N-butan-2-yl-2-(4,12-diethyl-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)acetamide (PubChem CID 53298229) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is N-butan-2-yl-2-(4,12-diethyl-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)acetamide.
| Compound Name | N-butan-2-yl-2-(4,12-diethyl-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)acetamide |
|---|---|
| PubChem CID | 53298229 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | N-butan-2-yl-2-(4,12-diethyl-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)acetamide |
| SMILES | CCc1cc2c(cc3c(=O)n(CC(=O)NC(C)CC)nc(CC)n32)s1 |
| InChI | InChI=1S/C18H24N4O2S/c1-5-11(4)19-17(23)10-21-18(24)14-9-15-13(8-12(6-2)25-15)22(14)16(7-3)20-21/h8-9,11H,5-7,10H2,1-4H3,(H,19,23) |
| InChIKey | MBTKVIBILFJFFW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |