C20H26N4O2S — CID 20884424
2-(12-ethyl-4-methyl-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)-N-(4-methylcyclohexyl)acetamide (PubChem CID 20884424) has the molecular formula C20H26N4O2S and a molecular weight of 386.52 g/mol. Its IUPAC name is 2-(12-ethyl-4-methyl-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)-N-(4-methylcyclohexyl)acetamide.
| Compound Name | 2-(12-ethyl-4-methyl-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)-N-(4-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 20884424 |
| Molecular Formula | C20H26N4O2S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 2-(12-ethyl-4-methyl-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)-N-(4-methylcyclohexyl)acetamide |
| SMILES | CCc1nn(CC(=O)NC2CCC(C)CC2)c(=O)c2cc3sc(C)cc3n12 |
| InChI | InChI=1S/C20H26N4O2S/c1-4-18-22-23(11-19(25)21-14-7-5-12(2)6-8-14)20(26)16-10-17-15(24(16)18)9-13(3)27-17/h9-10,12,14H,4-8,11H2,1-3H3,(H,21,25) |
| InChIKey | DDWJAGZQEBBFGY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |