C22H27N3O3 — CID 20888642
N-cyclopentyl-4-[[(3,4-dioxo-2-piperidin-1-ylcyclobuten-1-yl)amino]methyl]benzamide (PubChem CID 20888642) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-cyclopentyl-4-[[(3,4-dioxo-2-piperidin-1-ylcyclobuten-1-yl)amino]methyl]benzamide.
| Compound Name | N-cyclopentyl-4-[[(3,4-dioxo-2-piperidin-1-ylcyclobuten-1-yl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 20888642 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | N-cyclopentyl-4-[[(3,4-dioxo-2-piperidin-1-ylcyclobuten-1-yl)amino]methyl]benzamide |
| SMILES | O=C(NC1CCCC1)c1ccc(CNc2c(N3CCCCC3)c(=O)c2=O)cc1 |
| InChI | InChI=1S/C22H27N3O3/c26-20-18(19(21(20)27)25-12-4-1-5-13-25)23-14-15-8-10-16(11-9-15)22(28)24-17-6-2-3-7-17/h8-11,17,23H,1-7,12-14H2,(H,24,28) |
| InChIKey | DXYHCMVOODPJSG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|