C25H33N3O3 — CID 15945491
4-[[[2-(cyclohexylamino)-3,4-dioxocyclobuten-1-yl]amino]methyl]-N-(4-methylcyclohexyl)benzamide (PubChem CID 15945491) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is 4-[[[2-(cyclohexylamino)-3,4-dioxocyclobuten-1-yl]amino]methyl]-N-(4-methylcyclohexyl)benzamide.
| Compound Name | 4-[[[2-(cyclohexylamino)-3,4-dioxocyclobuten-1-yl]amino]methyl]-N-(4-methylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 15945491 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | 4-[[[2-(cyclohexylamino)-3,4-dioxocyclobuten-1-yl]amino]methyl]-N-(4-methylcyclohexyl)benzamide |
| SMILES | CC1CCC(NC(=O)c2ccc(CNc3c(NC4CCCCC4)c(=O)c3=O)cc2)CC1 |
| InChI | InChI=1S/C25H33N3O3/c1-16-7-13-20(14-8-16)28-25(31)18-11-9-17(10-12-18)15-26-21-22(24(30)23(21)29)27-19-5-3-2-4-6-19/h9-12,16,19-20,26-27H,2-8,13-15H2,1H3,(H,28,31) |
| InChIKey | AQDJQCKVDFDMRV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|