C24H24ClN3O3 — CID 20888626
N-[(2-chlorophenyl)methyl]-4-[[[2-(cyclopentylamino)-3,4-dioxocyclobuten-1-yl]amino]methyl]benzamide (PubChem CID 20888626) has the molecular formula C24H24ClN3O3 and a molecular weight of 437.93 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-4-[[[2-(cyclopentylamino)-3,4-dioxocyclobuten-1-yl]amino]methyl]benzamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-4-[[[2-(cyclopentylamino)-3,4-dioxocyclobuten-1-yl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 20888626 |
| Molecular Formula | C24H24ClN3O3 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-4-[[[2-(cyclopentylamino)-3,4-dioxocyclobuten-1-yl]amino]methyl]benzamide |
| SMILES | O=C(NCc1ccccc1Cl)c1ccc(CNc2c(NC3CCCC3)c(=O)c2=O)cc1 |
| InChI | InChI=1S/C24H24ClN3O3/c25-19-8-4-1-5-17(19)14-27-24(31)16-11-9-15(10-12-16)13-26-20-21(23(30)22(20)29)28-18-6-2-3-7-18/h1,4-5,8-12,18,26,28H,2-3,6-7,13-14H2,(H,27,31) |
| InChIKey | OTRIYJXXCRRTPN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|