C25H27N3O4 — CID 46261461
4-[[[2-(cyclohexylamino)-3,4-dioxocyclobuten-1-yl]amino]methyl]-N-(3-methoxyphenyl)benzamide (PubChem CID 46261461) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is 4-[[[2-(cyclohexylamino)-3,4-dioxocyclobuten-1-yl]amino]methyl]-N-(3-methoxyphenyl)benzamide.
| Compound Name | 4-[[[2-(cyclohexylamino)-3,4-dioxocyclobuten-1-yl]amino]methyl]-N-(3-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 46261461 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 4-[[[2-(cyclohexylamino)-3,4-dioxocyclobuten-1-yl]amino]methyl]-N-(3-methoxyphenyl)benzamide |
| SMILES | COc1cccc(NC(=O)c2ccc(CNc3c(NC4CCCCC4)c(=O)c3=O)cc2)c1 |
| InChI | InChI=1S/C25H27N3O4/c1-32-20-9-5-8-19(14-20)28-25(31)17-12-10-16(11-13-17)15-26-21-22(24(30)23(21)29)27-18-6-3-2-4-7-18/h5,8-14,18,26-27H,2-4,6-7,15H2,1H3,(H,28,31) |
| InChIKey | BJZNFCAXNZLLDQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|