C24H30N4O5 — CID 46261371
ethyl 4-[4-[[[2-(cyclopentylamino)-3,4-dioxocyclobuten-1-yl]amino]methyl]benzoyl]piperazine-1-carboxylate (PubChem CID 46261371) has the molecular formula C24H30N4O5 and a molecular weight of 454.53 g/mol. Its IUPAC name is ethyl 4-[4-[[[2-(cyclopentylamino)-3,4-dioxocyclobuten-1-yl]amino]methyl]benzoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[4-[[[2-(cyclopentylamino)-3,4-dioxocyclobuten-1-yl]amino]methyl]benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 46261371 |
| Molecular Formula | C24H30N4O5 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | ethyl 4-[4-[[[2-(cyclopentylamino)-3,4-dioxocyclobuten-1-yl]amino]methyl]benzoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2ccc(CNc3c(NC4CCCC4)c(=O)c3=O)cc2)CC1 |
| InChI | InChI=1S/C24H30N4O5/c1-2-33-24(32)28-13-11-27(12-14-28)23(31)17-9-7-16(8-10-17)15-25-19-20(22(30)21(19)29)26-18-5-3-4-6-18/h7-10,18,25-26H,2-6,11-15H2,1H3 |
| InChIKey | HQHDLGSCMFGHQL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|