C24H29N5OS — CID 20889496
1-[5-(2,5-dimethylpyrrol-1-yl)-1,3,4-thiadiazol-2-yl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)piperidine-4-carboxamide (PubChem CID 20889496) has the molecular formula C24H29N5OS and a molecular weight of 435.60 g/mol. Its IUPAC name is 1-[5-(2,5-dimethylpyrrol-1-yl)-1,3,4-thiadiazol-2-yl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)piperidine-4-carboxamide.
| Compound Name | 1-[5-(2,5-dimethylpyrrol-1-yl)-1,3,4-thiadiazol-2-yl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20889496 |
| Molecular Formula | C24H29N5OS |
| Molecular Weight | 435.60 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | 1-[5-(2,5-dimethylpyrrol-1-yl)-1,3,4-thiadiazol-2-yl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)piperidine-4-carboxamide |
| SMILES | Cc1ccc(C)n1-c1nnc(N2CCC(C(=O)NC3CCCc4ccccc43)CC2)s1 |
| InChI | InChI=1S/C24H29N5OS/c1-16-10-11-17(2)29(16)24-27-26-23(31-24)28-14-12-19(13-15-28)22(30)25-21-9-5-7-18-6-3-4-8-20(18)21/h3-4,6,8,10-11,19,21H,5,7,9,12-15H2,1-2H3,(H,25,30) |
| InChIKey | FSCRFUFABGIXEX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.60 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |