C23H29N5OS — CID 20889478
1-[5-(2,5-dimethylpyrrol-1-yl)-1,3,4-thiadiazol-2-yl]-N-(3-phenylpropyl)piperidine-4-carboxamide (PubChem CID 20889478) has the molecular formula C23H29N5OS and a molecular weight of 423.59 g/mol. Its IUPAC name is 1-[5-(2,5-dimethylpyrrol-1-yl)-1,3,4-thiadiazol-2-yl]-N-(3-phenylpropyl)piperidine-4-carboxamide.
| Compound Name | 1-[5-(2,5-dimethylpyrrol-1-yl)-1,3,4-thiadiazol-2-yl]-N-(3-phenylpropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20889478 |
| Molecular Formula | C23H29N5OS |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 1-[5-(2,5-dimethylpyrrol-1-yl)-1,3,4-thiadiazol-2-yl]-N-(3-phenylpropyl)piperidine-4-carboxamide |
| SMILES | Cc1ccc(C)n1-c1nnc(N2CCC(C(=O)NCCCc3ccccc3)CC2)s1 |
| InChI | InChI=1S/C23H29N5OS/c1-17-10-11-18(2)28(17)23-26-25-22(30-23)27-15-12-20(13-16-27)21(29)24-14-6-9-19-7-4-3-5-8-19/h3-5,7-8,10-11,20H,6,9,12-16H2,1-2H3,(H,24,29) |
| InChIKey | UMNSTZWVGXVWOA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|