C22H35N7OS — CID 3240892
N-[3-(4-propylpiperazin-1-yl)propyl]-1-(5-pyrrol-1-yl-1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide (PubChem CID 3240892) has the molecular formula C22H35N7OS and a molecular weight of 445.64 g/mol. Its IUPAC name is N-[3-(4-propylpiperazin-1-yl)propyl]-1-(5-pyrrol-1-yl-1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide.
| Compound Name | N-[3-(4-propylpiperazin-1-yl)propyl]-1-(5-pyrrol-1-yl-1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3240892 |
| Molecular Formula | C22H35N7OS |
| Molecular Weight | 445.64 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | N-[3-(4-propylpiperazin-1-yl)propyl]-1-(5-pyrrol-1-yl-1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide |
| SMILES | CCCN1CCN(CCCNC(=O)C2CCN(c3nnc(-n4cccc4)s3)CC2)CC1 |
| InChI | InChI=1S/C22H35N7OS/c1-2-9-26-15-17-27(18-16-26)10-5-8-23-20(30)19-6-13-29(14-7-19)22-25-24-21(31-22)28-11-3-4-12-28/h3-4,11-12,19H,2,5-10,13-18H2,1H3,(H,23,30) |
| InChIKey | UYYWPYVFCGQSSL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 69.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.64 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|