C16H25N5O2S — CID 20958204
N-butyl-1-[5-(2-oxopyrrolidin-1-yl)-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide (PubChem CID 20958204) has the molecular formula C16H25N5O2S and a molecular weight of 351.48 g/mol. Its IUPAC name is N-butyl-1-[5-(2-oxopyrrolidin-1-yl)-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide.
| Compound Name | N-butyl-1-[5-(2-oxopyrrolidin-1-yl)-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20958204 |
| Molecular Formula | C16H25N5O2S |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | N-butyl-1-[5-(2-oxopyrrolidin-1-yl)-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide |
| SMILES | CCCCNC(=O)C1CCN(c2nnc(N3CCCC3=O)s2)CC1 |
| InChI | InChI=1S/C16H25N5O2S/c1-2-3-8-17-14(23)12-6-10-20(11-7-12)15-18-19-16(24-15)21-9-4-5-13(21)22/h12H,2-11H2,1H3,(H,17,23) |
| InChIKey | CPRPZIKKPZJBHL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|