C20H32N6O3S — CID 20958330
N-(3-morpholin-4-ylpropyl)-1-[5-(2-oxopiperidin-1-yl)-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide (PubChem CID 20958330) has the molecular formula C20H32N6O3S and a molecular weight of 436.58 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-1-[5-(2-oxopiperidin-1-yl)-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)-1-[5-(2-oxopiperidin-1-yl)-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20958330 |
| Molecular Formula | C20H32N6O3S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-1-[5-(2-oxopiperidin-1-yl)-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide |
| SMILES | O=C(NCCCN1CCOCC1)C1CCN(c2nnc(N3CCCCC3=O)s2)CC1 |
| InChI | InChI=1S/C20H32N6O3S/c27-17-4-1-2-9-26(17)20-23-22-19(30-20)25-10-5-16(6-11-25)18(28)21-7-3-8-24-12-14-29-15-13-24/h16H,1-15H2,(H,21,28) |
| InChIKey | HGFWKHFNJVOEOB-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|