C25H36N6O2S — CID 22513416
N-[3-[benzyl(propan-2-yl)amino]propyl]-1-[5-(2-oxopyrrolidin-1-yl)-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide (PubChem CID 22513416) has the molecular formula C25H36N6O2S and a molecular weight of 484.67 g/mol. Its IUPAC name is N-[3-[benzyl(propan-2-yl)amino]propyl]-1-[5-(2-oxopyrrolidin-1-yl)-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide.
| Compound Name | N-[3-[benzyl(propan-2-yl)amino]propyl]-1-[5-(2-oxopyrrolidin-1-yl)-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 22513416 |
| Molecular Formula | C25H36N6O2S |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | N-[3-[benzyl(propan-2-yl)amino]propyl]-1-[5-(2-oxopyrrolidin-1-yl)-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide |
| SMILES | CC(C)N(CCCNC(=O)C1CCN(c2nnc(N3CCCC3=O)s2)CC1)Cc1ccccc1 |
| InChI | InChI=1S/C25H36N6O2S/c1-19(2)30(18-20-8-4-3-5-9-20)14-7-13-26-23(33)21-11-16-29(17-12-21)24-27-28-25(34-24)31-15-6-10-22(31)32/h3-5,8-9,19,21H,6-7,10-18H2,1-2H3,(H,26,33) |
| InChIKey | FOLPZDKWLCKCFE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|