C21H27N5O2S — CID 92678856
(3S)-1-[5-(2-oxopyrrolidin-1-yl)-1,3,4-thiadiazol-2-yl]-N-(3-phenylpropyl)piperidine-3-carboxamide (PubChem CID 92678856) has the molecular formula C21H27N5O2S and a molecular weight of 413.55 g/mol. Its IUPAC name is (3S)-1-[5-(2-oxopyrrolidin-1-yl)-1,3,4-thiadiazol-2-yl]-N-(3-phenylpropyl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-[5-(2-oxopyrrolidin-1-yl)-1,3,4-thiadiazol-2-yl]-N-(3-phenylpropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92678856 |
| Molecular Formula | C21H27N5O2S |
| Molecular Weight | 413.55 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | (3S)-1-[5-(2-oxopyrrolidin-1-yl)-1,3,4-thiadiazol-2-yl]-N-(3-phenylpropyl)piperidine-3-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)[C@H]1CCCN(c2nnc(N3CCCC3=O)s2)C1 |
| InChI | InChI=1S/C21H27N5O2S/c27-18-11-6-14-26(18)21-24-23-20(29-21)25-13-5-10-17(15-25)19(28)22-12-4-9-16-7-2-1-3-8-16/h1-3,7-8,17H,4-6,9-15H2,(H,22,28)/t17-/m0/s1 |
| InChIKey | LLVFYOYSYZARHJ-KRWDZBQOSA-N |
| XLogP | 2.63 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.55 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|