C24H34N6O2S — CID 20958153
N-[3-[benzyl(ethyl)amino]propyl]-1-[5-(2-oxopyrrolidin-1-yl)-1,3,4-thiadiazol-2-yl]piperidine-3-carboxamide (PubChem CID 20958153) has the molecular formula C24H34N6O2S and a molecular weight of 470.64 g/mol. Its IUPAC name is N-[3-[benzyl(ethyl)amino]propyl]-1-[5-(2-oxopyrrolidin-1-yl)-1,3,4-thiadiazol-2-yl]piperidine-3-carboxamide.
| Compound Name | N-[3-[benzyl(ethyl)amino]propyl]-1-[5-(2-oxopyrrolidin-1-yl)-1,3,4-thiadiazol-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 20958153 |
| Molecular Formula | C24H34N6O2S |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | N-[3-[benzyl(ethyl)amino]propyl]-1-[5-(2-oxopyrrolidin-1-yl)-1,3,4-thiadiazol-2-yl]piperidine-3-carboxamide |
| SMILES | CCN(CCCNC(=O)C1CCCN(c2nnc(N3CCCC3=O)s2)C1)Cc1ccccc1 |
| InChI | InChI=1S/C24H34N6O2S/c1-2-28(17-19-9-4-3-5-10-19)14-8-13-25-22(32)20-11-6-15-29(18-20)23-26-27-24(33-23)30-16-7-12-21(30)31/h3-5,9-10,20H,2,6-8,11-18H2,1H3,(H,25,32) |
| InChIKey | SHZSZCOMVXRYSA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|