C34H50N8O2S — CID 46260793
N-[3-(4-cyclohexylpiperazin-1-yl)propyl]-1-[5-[2-[(4-ethoxyanilino)methyl]pyrrol-1-yl]-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide (PubChem CID 46260793) has the molecular formula C34H50N8O2S and a molecular weight of 634.90 g/mol. Its IUPAC name is N-[3-(4-cyclohexylpiperazin-1-yl)propyl]-1-[5-[2-[(4-ethoxyanilino)methyl]pyrrol-1-yl]-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide.
| Compound Name | N-[3-(4-cyclohexylpiperazin-1-yl)propyl]-1-[5-[2-[(4-ethoxyanilino)methyl]pyrrol-1-yl]-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46260793 |
| Molecular Formula | C34H50N8O2S |
| Molecular Weight | 634.90 g/mol |
| Exact Mass | 634.38 |
| IUPAC Name | N-[3-(4-cyclohexylpiperazin-1-yl)propyl]-1-[5-[2-[(4-ethoxyanilino)methyl]pyrrol-1-yl]-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide |
| SMILES | CCOc1ccc(NCc2cccn2-c2nnc(N3CCC(C(=O)NCCCN4CCN(C5CCCCC5)CC4)CC3)s2)cc1 |
| InChI | InChI=1S/C34H50N8O2S/c1-2-44-31-13-11-28(12-14-31)36-26-30-10-6-19-42(30)34-38-37-33(45-34)41-20-15-27(16-21-41)32(43)35-17-7-18-39-22-24-40(25-23-39)29-8-4-3-5-9-29/h6,10-14,19,27,29,36H,2-5,7-9,15-18,20-26H2,1H3,(H,35,43) |
| InChIKey | VNADSVMZPQYPRQ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.90 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|