C30H45N7O2S — CID 46260814
N-[3-(dipropylamino)propyl]-1-[5-[2-[(4-ethoxyanilino)methyl]pyrrol-1-yl]-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide (PubChem CID 46260814) has the molecular formula C30H45N7O2S and a molecular weight of 567.80 g/mol. Its IUPAC name is N-[3-(dipropylamino)propyl]-1-[5-[2-[(4-ethoxyanilino)methyl]pyrrol-1-yl]-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide.
| Compound Name | N-[3-(dipropylamino)propyl]-1-[5-[2-[(4-ethoxyanilino)methyl]pyrrol-1-yl]-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46260814 |
| Molecular Formula | C30H45N7O2S |
| Molecular Weight | 567.80 g/mol |
| Exact Mass | 567.34 |
| IUPAC Name | N-[3-(dipropylamino)propyl]-1-[5-[2-[(4-ethoxyanilino)methyl]pyrrol-1-yl]-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide |
| SMILES | CCCN(CCC)CCCNC(=O)C1CCN(c2nnc(-n3cccc3CNc3ccc(OCC)cc3)s2)CC1 |
| InChI | InChI=1S/C30H45N7O2S/c1-4-17-35(18-5-2)19-8-16-31-28(38)24-14-21-36(22-15-24)29-33-34-30(40-29)37-20-7-9-26(37)23-32-25-10-12-27(13-11-25)39-6-3/h7,9-13,20,24,32H,4-6,8,14-19,21-23H2,1-3H3,(H,31,38) |
| InChIKey | JHFDODMROWJXGN-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 87.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.80 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|