C21H34N6OS — CID 46335786
N-[3-[butyl(ethyl)amino]propyl]-1-(5-piperidin-1-yl-1,3,4-thiadiazol-2-yl)pyrrole-2-carboxamide (PubChem CID 46335786) has the molecular formula C21H34N6OS and a molecular weight of 418.61 g/mol. Its IUPAC name is N-[3-[butyl(ethyl)amino]propyl]-1-(5-piperidin-1-yl-1,3,4-thiadiazol-2-yl)pyrrole-2-carboxamide.
| Compound Name | N-[3-[butyl(ethyl)amino]propyl]-1-(5-piperidin-1-yl-1,3,4-thiadiazol-2-yl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 46335786 |
| Molecular Formula | C21H34N6OS |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | N-[3-[butyl(ethyl)amino]propyl]-1-(5-piperidin-1-yl-1,3,4-thiadiazol-2-yl)pyrrole-2-carboxamide |
| SMILES | CCCCN(CC)CCCNC(=O)c1cccn1-c1nnc(N2CCCCC2)s1 |
| InChI | InChI=1S/C21H34N6OS/c1-3-5-13-25(4-2)14-10-12-22-19(28)18-11-9-17-27(18)21-24-23-20(29-21)26-15-7-6-8-16-26/h9,11,17H,3-8,10,12-16H2,1-2H3,(H,22,28) |
| InChIKey | QZSJRZYHYVKOJN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|