C19H28N6O2S — CID 46335773
N-(3-morpholin-4-ylpropyl)-1-(5-piperidin-1-yl-1,3,4-thiadiazol-2-yl)pyrrole-2-carboxamide (PubChem CID 46335773) has the molecular formula C19H28N6O2S and a molecular weight of 404.54 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-1-(5-piperidin-1-yl-1,3,4-thiadiazol-2-yl)pyrrole-2-carboxamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)-1-(5-piperidin-1-yl-1,3,4-thiadiazol-2-yl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 46335773 |
| Molecular Formula | C19H28N6O2S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-1-(5-piperidin-1-yl-1,3,4-thiadiazol-2-yl)pyrrole-2-carboxamide |
| SMILES | O=C(NCCCN1CCOCC1)c1cccn1-c1nnc(N2CCCCC2)s1 |
| InChI | InChI=1S/C19H28N6O2S/c26-17(20-7-5-8-23-12-14-27-15-13-23)16-6-4-11-25(16)19-22-21-18(28-19)24-9-2-1-3-10-24/h4,6,11H,1-3,5,7-10,12-15H2,(H,20,26) |
| InChIKey | QRRJPEOUPGWEKX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|