C25H32FN7OS — CID 46335796
N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-1-(5-piperidin-1-yl-1,3,4-thiadiazol-2-yl)pyrrole-2-carboxamide (PubChem CID 46335796) has the molecular formula C25H32FN7OS and a molecular weight of 497.64 g/mol. Its IUPAC name is N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-1-(5-piperidin-1-yl-1,3,4-thiadiazol-2-yl)pyrrole-2-carboxamide.
| Compound Name | N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-1-(5-piperidin-1-yl-1,3,4-thiadiazol-2-yl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 46335796 |
| Molecular Formula | C25H32FN7OS |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-1-(5-piperidin-1-yl-1,3,4-thiadiazol-2-yl)pyrrole-2-carboxamide |
| SMILES | O=C(NCCCN1CCN(c2ccc(F)cc2)CC1)c1cccn1-c1nnc(N2CCCCC2)s1 |
| InChI | InChI=1S/C25H32FN7OS/c26-20-7-9-21(10-8-20)31-18-16-30(17-19-31)12-5-11-27-23(34)22-6-4-15-33(22)25-29-28-24(35-25)32-13-2-1-3-14-32/h4,6-10,15H,1-3,5,11-14,16-19H2,(H,27,34) |
| InChIKey | MPXVFGGBLAZHBD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 69.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|