C24H30FN7OS — CID 46335708
N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-1-(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)pyrrole-2-carboxamide (PubChem CID 46335708) has the molecular formula C24H30FN7OS and a molecular weight of 483.62 g/mol. Its IUPAC name is N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-1-(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)pyrrole-2-carboxamide.
| Compound Name | N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-1-(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 46335708 |
| Molecular Formula | C24H30FN7OS |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-1-(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)pyrrole-2-carboxamide |
| SMILES | O=C(NCCCN1CCN(c2ccccc2F)CC1)c1cccn1-c1nnc(N2CCCC2)s1 |
| InChI | InChI=1S/C24H30FN7OS/c25-19-7-1-2-8-20(19)30-17-15-29(16-18-30)11-6-10-26-22(33)21-9-5-14-32(21)24-28-27-23(34-24)31-12-3-4-13-31/h1-2,5,7-9,14H,3-4,6,10-13,15-18H2,(H,26,33) |
| InChIKey | CYNCBMIYNJTKCD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 69.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|