C25H34N6O2S — CID 46281727
N-[[1-[5-(4-cyclohexylpiperazin-1-yl)-1,3,4-thiadiazol-2-yl]pyrrol-2-yl]methyl]-3,4-dimethoxyaniline (PubChem CID 46281727) has the molecular formula C25H34N6O2S and a molecular weight of 482.65 g/mol. Its IUPAC name is N-[[1-[5-(4-cyclohexylpiperazin-1-yl)-1,3,4-thiadiazol-2-yl]pyrrol-2-yl]methyl]-3,4-dimethoxyaniline.
| Compound Name | N-[[1-[5-(4-cyclohexylpiperazin-1-yl)-1,3,4-thiadiazol-2-yl]pyrrol-2-yl]methyl]-3,4-dimethoxyaniline |
|---|---|
| PubChem CID | 46281727 |
| Molecular Formula | C25H34N6O2S |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | N-[[1-[5-(4-cyclohexylpiperazin-1-yl)-1,3,4-thiadiazol-2-yl]pyrrol-2-yl]methyl]-3,4-dimethoxyaniline |
| SMILES | COc1ccc(NCc2cccn2-c2nnc(N3CCN(C4CCCCC4)CC3)s2)cc1OC |
| InChI | InChI=1S/C25H34N6O2S/c1-32-22-11-10-19(17-23(22)33-2)26-18-21-9-6-12-31(21)25-28-27-24(34-25)30-15-13-29(14-16-30)20-7-4-3-5-8-20/h6,9-12,17,20,26H,3-5,7-8,13-16,18H2,1-2H3 |
| InChIKey | XHGZMZYMWOBFDF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 67.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|