C21H28N6O2S — CID 46281779
N-[[1-[5-(4-ethylpiperazin-1-yl)-1,3,4-thiadiazol-2-yl]pyrrol-2-yl]methyl]-2,4-dimethoxyaniline (PubChem CID 46281779) has the molecular formula C21H28N6O2S and a molecular weight of 428.56 g/mol. Its IUPAC name is N-[[1-[5-(4-ethylpiperazin-1-yl)-1,3,4-thiadiazol-2-yl]pyrrol-2-yl]methyl]-2,4-dimethoxyaniline.
| Compound Name | N-[[1-[5-(4-ethylpiperazin-1-yl)-1,3,4-thiadiazol-2-yl]pyrrol-2-yl]methyl]-2,4-dimethoxyaniline |
|---|---|
| PubChem CID | 46281779 |
| Molecular Formula | C21H28N6O2S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | N-[[1-[5-(4-ethylpiperazin-1-yl)-1,3,4-thiadiazol-2-yl]pyrrol-2-yl]methyl]-2,4-dimethoxyaniline |
| SMILES | CCN1CCN(c2nnc(-n3cccc3CNc3ccc(OC)cc3OC)s2)CC1 |
| InChI | InChI=1S/C21H28N6O2S/c1-4-25-10-12-26(13-11-25)20-23-24-21(30-20)27-9-5-6-16(27)15-22-18-8-7-17(28-2)14-19(18)29-3/h5-9,14,22H,4,10-13,15H2,1-3H3 |
| InChIKey | HCARNPAFMMBYNL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 67.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|