C20H26N6O2S — CID 20926691
2,4-dimethoxy-N-[[1-[5-(4-methylpiperazin-1-yl)-1,3,4-thiadiazol-2-yl]pyrrol-2-yl]methyl]aniline (PubChem CID 20926691) has the molecular formula C20H26N6O2S and a molecular weight of 414.54 g/mol. Its IUPAC name is 2,4-dimethoxy-N-[[1-[5-(4-methylpiperazin-1-yl)-1,3,4-thiadiazol-2-yl]pyrrol-2-yl]methyl]aniline.
| Compound Name | 2,4-dimethoxy-N-[[1-[5-(4-methylpiperazin-1-yl)-1,3,4-thiadiazol-2-yl]pyrrol-2-yl]methyl]aniline |
|---|---|
| PubChem CID | 20926691 |
| Molecular Formula | C20H26N6O2S |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 2,4-dimethoxy-N-[[1-[5-(4-methylpiperazin-1-yl)-1,3,4-thiadiazol-2-yl]pyrrol-2-yl]methyl]aniline |
| SMILES | COc1ccc(NCc2cccn2-c2nnc(N3CCN(C)CC3)s2)c(OC)c1 |
| InChI | InChI=1S/C20H26N6O2S/c1-24-9-11-25(12-10-24)19-22-23-20(29-19)26-8-4-5-15(26)14-21-17-7-6-16(27-2)13-18(17)28-3/h4-8,13,21H,9-12,14H2,1-3H3 |
| InChIKey | WOSPZXZOWHOQTI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 67.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|