C26H32N4O — CID 46333856
1-[3-(2,5-dimethylpyrrol-1-yl)-2-pyridinyl]-N-(3-phenylpropyl)piperidine-4-carboxamide (PubChem CID 46333856) has the molecular formula C26H32N4O and a molecular weight of 416.57 g/mol. Its IUPAC name is 1-[3-(2,5-dimethylpyrrol-1-yl)-2-pyridinyl]-N-(3-phenylpropyl)piperidine-4-carboxamide.
| Compound Name | 1-[3-(2,5-dimethylpyrrol-1-yl)-2-pyridinyl]-N-(3-phenylpropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46333856 |
| Molecular Formula | C26H32N4O |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | 1-[3-(2,5-dimethylpyrrol-1-yl)-2-pyridinyl]-N-(3-phenylpropyl)piperidine-4-carboxamide |
| SMILES | Cc1ccc(C)n1-c1cccnc1N1CCC(C(=O)NCCCc2ccccc2)CC1 |
| InChI | InChI=1S/C26H32N4O/c1-20-12-13-21(2)30(20)24-11-7-16-27-25(24)29-18-14-23(15-19-29)26(31)28-17-6-10-22-8-4-3-5-9-22/h3-5,7-9,11-13,16,23H,6,10,14-15,17-19H2,1-2H3,(H,28,31) |
| InChIKey | DXZIKCXHOVSOMB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|