C25H28N4OS — CID 53129966
N-(3-phenylpropyl)-1-(3-phenylsulfanylpyrazin-2-yl)piperidine-4-carboxamide (PubChem CID 53129966) has the molecular formula C25H28N4OS and a molecular weight of 432.59 g/mol. Its IUPAC name is N-(3-phenylpropyl)-1-(3-phenylsulfanylpyrazin-2-yl)piperidine-4-carboxamide.
| Compound Name | N-(3-phenylpropyl)-1-(3-phenylsulfanylpyrazin-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 53129966 |
| Molecular Formula | C25H28N4OS |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | N-(3-phenylpropyl)-1-(3-phenylsulfanylpyrazin-2-yl)piperidine-4-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)C1CCN(c2nccnc2Sc2ccccc2)CC1 |
| InChI | InChI=1S/C25H28N4OS/c30-24(27-15-7-10-20-8-3-1-4-9-20)21-13-18-29(19-14-21)23-25(28-17-16-26-23)31-22-11-5-2-6-12-22/h1-6,8-9,11-12,16-17,21H,7,10,13-15,18-19H2,(H,27,30) |
| InChIKey | NEAJXIDHCQAOFI-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|