C20H23N5OS — CID 123200584
N-(3-phenylpropyl)-1-([1,2,5]thiadiazolo[3,4-b]pyridin-7-yl)piperidine-4-carboxamide (PubChem CID 123200584) has the molecular formula C20H23N5OS and a molecular weight of 381.51 g/mol. Its IUPAC name is N-(3-phenylpropyl)-1-([1,2,5]thiadiazolo[3,4-b]pyridin-7-yl)piperidine-4-carboxamide.
| Compound Name | N-(3-phenylpropyl)-1-([1,2,5]thiadiazolo[3,4-b]pyridin-7-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 123200584 |
| Molecular Formula | C20H23N5OS |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | N-(3-phenylpropyl)-1-([1,2,5]thiadiazolo[3,4-b]pyridin-7-yl)piperidine-4-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)C1CCN(c2ccnc3nsnc23)CC1 |
| InChI | InChI=1S/C20H23N5OS/c26-20(22-11-4-7-15-5-2-1-3-6-15)16-9-13-25(14-10-16)17-8-12-21-19-18(17)23-27-24-19/h1-3,5-6,8,12,16H,4,7,9-11,13-14H2,(H,22,26) |
| InChIKey | XJSCOSRNMLBIGN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|