C26H32N2O3 — CID 20891412
4-[[2-(4-ethoxyphenyl)ethylamino]methyl]-2,5-dimethyl-1-[(4-methylphenyl)methyl]pyrrole-3-carboxylic acid (PubChem CID 20891412) has the molecular formula C26H32N2O3 and a molecular weight of 420.55 g/mol. Its IUPAC name is 4-[[2-(4-ethoxyphenyl)ethylamino]methyl]-2,5-dimethyl-1-[(4-methylphenyl)methyl]pyrrole-3-carboxylic acid.
| Compound Name | 4-[[2-(4-ethoxyphenyl)ethylamino]methyl]-2,5-dimethyl-1-[(4-methylphenyl)methyl]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 20891412 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | 4-[[2-(4-ethoxyphenyl)ethylamino]methyl]-2,5-dimethyl-1-[(4-methylphenyl)methyl]pyrrole-3-carboxylic acid |
| SMILES | CCOc1ccc(CCNCc2c(C(=O)O)c(C)n(Cc3ccc(C)cc3)c2C)cc1 |
| InChI | InChI=1S/C26H32N2O3/c1-5-31-23-12-10-21(11-13-23)14-15-27-16-24-19(3)28(20(4)25(24)26(29)30)17-22-8-6-18(2)7-9-22/h6-13,27H,5,14-17H2,1-4H3,(H,29,30) |
| InChIKey | NYKXVDSRRDPXFA-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|