C23H24Cl2N2O2 — CID 20957689
4-[[2-(4-chlorophenyl)ethylamino]methyl]-1-[(3-chlorophenyl)methyl]-2,5-dimethylpyrrole-3-carboxylic acid (PubChem CID 20957689) has the molecular formula C23H24Cl2N2O2 and a molecular weight of 431.36 g/mol. Its IUPAC name is 4-[[2-(4-chlorophenyl)ethylamino]methyl]-1-[(3-chlorophenyl)methyl]-2,5-dimethylpyrrole-3-carboxylic acid.
| Compound Name | 4-[[2-(4-chlorophenyl)ethylamino]methyl]-1-[(3-chlorophenyl)methyl]-2,5-dimethylpyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 20957689 |
| Molecular Formula | C23H24Cl2N2O2 |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 4-[[2-(4-chlorophenyl)ethylamino]methyl]-1-[(3-chlorophenyl)methyl]-2,5-dimethylpyrrole-3-carboxylic acid |
| SMILES | Cc1c(CNCCc2ccc(Cl)cc2)c(C(=O)O)c(C)n1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H24Cl2N2O2/c1-15-21(13-26-11-10-17-6-8-19(24)9-7-17)22(23(28)29)16(2)27(15)14-18-4-3-5-20(25)12-18/h3-9,12,26H,10-11,13-14H2,1-2H3,(H,28,29) |
| InChIKey | ZDWWJUHDULSOTK-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|