C21H29ClN2O2S — CID 20957707
1-[(3-chlorophenyl)methyl]-2,5-dimethyl-4-[(3-propylsulfanylpropylamino)methyl]pyrrole-3-carboxylic acid (PubChem CID 20957707) has the molecular formula C21H29ClN2O2S and a molecular weight of 409.00 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-2,5-dimethyl-4-[(3-propylsulfanylpropylamino)methyl]pyrrole-3-carboxylic acid.
| Compound Name | 1-[(3-chlorophenyl)methyl]-2,5-dimethyl-4-[(3-propylsulfanylpropylamino)methyl]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 20957707 |
| Molecular Formula | C21H29ClN2O2S |
| Molecular Weight | 409.00 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-2,5-dimethyl-4-[(3-propylsulfanylpropylamino)methyl]pyrrole-3-carboxylic acid |
| SMILES | CCCSCCCNCc1c(C(=O)O)c(C)n(Cc2cccc(Cl)c2)c1C |
| InChI | InChI=1S/C21H29ClN2O2S/c1-4-10-27-11-6-9-23-13-19-15(2)24(16(3)20(19)21(25)26)14-17-7-5-8-18(22)12-17/h5,7-8,12,23H,4,6,9-11,13-14H2,1-3H3,(H,25,26) |
| InChIKey | WPVRAKJGSMECGP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.00 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|